CAS 2677885-13-9 is the registry number for 6-(Bromomethyl)-2-chlorothiazolo[5,4-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(bromomethyl)-2-chloro-[1,3]thiazolo[5,4-c]pyridine (CAS 2677885-13-9) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 6-(bromomethyl)-2-chloro-[1,3]thiazolo[5,4-c]pyridine. InChIKey: FBOHVHWKGXXBBI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 6-(bromomethyl)-2-chloro-[1,3]thiazolo[5,4-c]pyridine |
| InChIKey | FBOHVHWKGXXBBI-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=C1N=C(S2)Cl)CBr |
Computed by PubChem (NCBI)