CAS 951122-66-0 is the registry number for 2–(Bromomethyl)–6–chloropyrido(3,2–d)(1,3)thiazole. Offered by: GLPBio. Available pack sizes: 100mg.
2-(bromomethyl)-6-chloro-[1,3]thiazolo[5,4-b]pyridine (CAS 951122-66-0) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 2-(bromomethyl)-6-chloro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: QAMMELFTJCKUFT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 2-(bromomethyl)-6-chloro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | QAMMELFTJCKUFT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(S2)CBr)Cl |
Computed by PubChem (NCBI)