CAS 1082399-00-5 is the registry number for 4-(2,5-Dimethyloxazol-4-yl)benzenesulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride (CAS 1082399-00-5) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: DJUCKCOHCPVGJA-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride |
| InChIKey | DJUCKCOHCPVGJA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)