Products 1082399-00-5

CAS 1082399-00-5 is the registry number for 4-(2,5-Dimethyloxazol-4-yl)benzenesulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride (CAS 1082399-00-5) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: DJUCKCOHCPVGJA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO3S
Molecular weight271.72 g/mol
IUPAC name4-(2,5-dimethyl-1,3-oxazol-4-yl)benzenesulfonyl chloride
InChIKeyDJUCKCOHCPVGJA-UHFFFAOYSA-N
SMILESCC1=C(N=C(O1)C)C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)