Products 1087784-43-7
CAS 1087784-43-7 appears in our catalog under these names: [3-(4-Methylphenyl)isoxazol-5-yl]methanesulfonyl chloride, 95%, (3-(p-Tolyl)isoxazol-5-yl)methanesulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
[3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfonyl chloride (CAS 1087784-43-7) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfonyl chloride. InChIKey: HOEZINXYWURSSG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfonyl chloride |
| InChIKey | HOEZINXYWURSSG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)