CAS 1268026-52-3 appears in our catalog under these names: 11-Oxo-1-azatricyclo(6.3.1.0,4,12)dodeca-4(12),5,7-triene-6-sulfonyl chloride, 95%, 11-Oxo-1-azatricyclo(6.3.1.0,4,12)dodeca-4(12),5,7-triene-6-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-6-sulfonyl chloride (CAS 1268026-52-3) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-6-sulfonyl chloride. InChIKey: VWDHSLTXFBCAIG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-6-sulfonyl chloride |
| InChIKey | VWDHSLTXFBCAIG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2CCC3=CC(=CC1=C32)S(=O)(=O)Cl |
Computed by PubChem (NCBI)