CAS 1178081-96-3 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-methanesulfonylphenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(4-methanesulfonylphenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(chloromethyl)-2-(4-methylsulfonylphenyl)-1,3-oxazole (CAS 1178081-96-3) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-methylsulfonylphenyl)-1,3-oxazole. InChIKey: WJZKPLCHNWNZNZ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-methylsulfonylphenyl)-1,3-oxazole |
| InChIKey | WJZKPLCHNWNZNZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=NC(=CO2)CCl |
Computed by PubChem (NCBI)