CAS 32083-27-5 appears in our catalog under these names: 2-((4-Chlorophenyl)sulfonyl)-3-ethoxyprop-2-enenitrile, 95%, 2-((4-chlorophenyl)sulfonyl)-3-ethoxyprop-2-enenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
(E)-2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile (CAS 32083-27-5) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile. InChIKey: SUWQYQRJDNCPOP-DHZHZOJOSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile |
| InChIKey | SUWQYQRJDNCPOP-DHZHZOJOSA-N |
| SMILES | CCO/C=C(\C#N)/S(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)