CAS 1268334-77-5 appears in our catalog under these names: 2-Methyl-5-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride, 95%, 2-Methyl-5-(2-methyloxazol-5-yl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-methyl-5-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride (CAS 1268334-77-5) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 2-methyl-5-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: OLILLWFJVMQMQU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 2-methyl-5-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | OLILLWFJVMQMQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN=C(O2)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)