Products 1284186-31-7

CAS 1284186-31-7 is the registry number for 2-Methyl-5-(3-methyl-5-isoxazolyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride (CAS 1284186-31-7) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: YHCFVIKZEDVTDN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO3S
Molecular weight271.72 g/mol
IUPAC name2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride
InChIKeyYHCFVIKZEDVTDN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=CC(=NO2)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)