CAS 1284186-31-7 is the registry number for 2-Methyl-5-(3-methyl-5-isoxazolyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride (CAS 1284186-31-7) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: YHCFVIKZEDVTDN-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | YHCFVIKZEDVTDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=NO2)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)