CAS 2154-81-6 appears in our catalog under these names: 4-(3,5-Dimethyl-4-isoxazolyl)benzenesulfonyl chloride, 95%, 4-(3,5-Dimethylisoxazol-4-yl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-(3,5-dimethyl-1,2-oxazol-4-yl)benzenesulfonyl chloride (CAS 2154-81-6) is a chemical compound with the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. IUPAC name: 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: QJYNNCTYXNVRBN-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzenesulfonyl chloride |
| InChIKey | QJYNNCTYXNVRBN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)