CAS 108249-48-5 appears in our catalog under these names: 4-Oxo-4,5,6,7-tetrahydrobenzofuran-2-carboxylic acid, 98%, 4-Oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid, 4-Oxo-4，5，6，7-Tetrahydrobenzofuran-2-Carboxylic Acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g.
4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylic acid (CAS 108249-48-5) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylic acid. InChIKey: BWONXPWAUSMDDH-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylic acid |
| InChIKey | BWONXPWAUSMDDH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(O2)C(=O)O)C(=O)C1 |
Computed by PubChem (NCBI)