Products 122852-33-9
CAS 122852-33-9 is the registry number for (R)–2–Amino–3–(4–bromophenyl)propanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 122852-33-9) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: GRWMPXZZFAPLFZ-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | GRWMPXZZFAPLFZ-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-D-phenylalanine hydrochloride, (R)-2-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, (2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride, D-Phenylalanine, 4-bromo-, hydrochloride, D-Phenylalanine, 4-bromo-, hydrochloride (9CI), 4-Bromo-D-phenylalanine--hydrogen chloride (1/1)