CAS 62929-49-1 is the registry number for 1,2,3,4-Tetra-O-acetyl-D-xylopyranose, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 1g.
[(3R,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 62929-49-1) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3R,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-DAAZQVBGSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3R,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-DAAZQVBGSA-N |
| SMILES | CC(=O)O[C@@H]1COC([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)