CAS 4627-30-9 appears in our catalog under these names: (3R,4R,5R)-3,4,5-Tris(acetyloxy)oxan-2-yl acetate, 95%, (3r,4r,5r)–3,4,5–Tris(acetyloxy)oxan–2–yl acetate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg, 250mg, 50mg, 500mg.
[(3R,4R,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 4627-30-9) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3R,4R,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-PFGBXZAXSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3R,4R,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-PFGBXZAXSA-N |
| SMILES | CC(=O)O[C@@H]1COC([C@@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)