Products 123163-97-3
CAS 123163-97-3 appears in our catalog under these names: (3R,4S,5S)-Tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 97%, 1,2,3,4-Tetra-O-acetyl-L-arabinopyranose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2g, 1g, 5g, 10g.
[(3S,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 123163-97-3) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3S,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-ACJTYDJDSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3S,4S,5R)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-ACJTYDJDSA-N |
| SMILES | CC(=O)O[C@H]1COC([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)