Products 1092347-71-1
CAS 1092347-71-1 appears in our catalog under these names: 7-Fluoro-4-nitro-2,3-dihydro-1H-inden-1-one, 95%, 7-Fluoro-4-nitro-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
7-fluoro-4-nitro-2,3-dihydroinden-1-one (CAS 1092347-71-1) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 7-fluoro-4-nitro-2,3-dihydroinden-1-one. InChIKey: DNWKXBXLPVMDAG-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 7-fluoro-4-nitro-2,3-dihydroinden-1-one |
| InChIKey | DNWKXBXLPVMDAG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)[N+](=O)[O-])F |
Computed by PubChem (NCBI)