Products 314298-28-7

CAS 314298-28-7 is the registry number for 5-Cyano-4-fluoro-2-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-cyano-4-fluoro-2-methoxybenzoic acid (CAS 314298-28-7) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 5-cyano-4-fluoro-2-methoxybenzoic acid. InChIKey: DHLRZZROPUQGLE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6FNO3
Molecular weight195.15 g/mol
IUPAC name5-cyano-4-fluoro-2-methoxybenzoic acid
InChIKeyDHLRZZROPUQGLE-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)F)C#N)C(=O)O

Computed by PubChem (NCBI)