CAS 2121215-08-3 is the registry number for Methyl 7-fluorobenzo[c]isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-fluoro-2,1-benzoxazole-3-carboxylate (CAS 2121215-08-3) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: methyl 7-fluoro-2,1-benzoxazole-3-carboxylate. InChIKey: JEKPOTMXHGCSHK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | methyl 7-fluoro-2,1-benzoxazole-3-carboxylate |
| InChIKey | JEKPOTMXHGCSHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=C(C2=NO1)F |
Computed by PubChem (NCBI)