CAS 1893978-85-2 is the registry number for 5-Fluoro-3-methylbenzo[d]isoxazole-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-3-methyl-1,2-benzoxazole-6-carboxylic acid (CAS 1893978-85-2) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 5-fluoro-3-methyl-1,2-benzoxazole-6-carboxylic acid. InChIKey: JVMFOJXBUMODJS-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 5-fluoro-3-methyl-1,2-benzoxazole-6-carboxylic acid |
| InChIKey | JVMFOJXBUMODJS-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=CC(=C(C=C12)F)C(=O)O |
Computed by PubChem (NCBI)