CAS 1805456-35-2 appears in our catalog under these names: 4-Cyano-3-fluoro-5-methoxybenzoic acid, 95%, 4-Cyano-3-fluoro-5-methoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-cyano-3-fluoro-5-methoxybenzoic acid (CAS 1805456-35-2) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 4-cyano-3-fluoro-5-methoxybenzoic acid. InChIKey: PPBYPGRDGVOODD-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 4-cyano-3-fluoro-5-methoxybenzoic acid |
| InChIKey | PPBYPGRDGVOODD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)F)C#N |
Computed by PubChem (NCBI)