CAS 1383426-74-1 is the registry number for 5-Fluoro-1-methyl-1h-benzo[d][1,3]oxazine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-fluoro-1-methyl-3,1-benzoxazine-2,4-dione (CAS 1383426-74-1) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 5-fluoro-1-methyl-3,1-benzoxazine-2,4-dione. InChIKey: AKHVJQPMVFVKLH-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 5-fluoro-1-methyl-3,1-benzoxazine-2,4-dione |
| InChIKey | AKHVJQPMVFVKLH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)F)C(=O)OC1=O |
Computed by PubChem (NCBI)