Products 1523204-79-6
CAS 1523204-79-6 appears in our catalog under these names: 2-(2-Cyanophenoxy)-2-fluoroacetic acid, 95%, 2-(2-Cyanophenoxy)-2-fluoroacetic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 5g.
2-(2-cyanophenoxy)-2-fluoroacetic acid (CAS 1523204-79-6) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 2-(2-cyanophenoxy)-2-fluoroacetic acid. InChIKey: WPPDDNKKUDYVMF-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 2-(2-cyanophenoxy)-2-fluoroacetic acid |
| InChIKey | WPPDDNKKUDYVMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC(C(=O)O)F |
Computed by PubChem (NCBI)