CAS 616224-66-9 appears in our catalog under these names: 6-Fluoro-5-methyl-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione, 95%, 6-Fluoro-5-methyl-2H-benzo(D)(1,3)oxazine-2,4(1H)-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-fluoro-5-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 616224-66-9) is a chemical compound with the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. IUPAC name: 6-fluoro-5-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: FOPGFTASWNNYSM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO3 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 6-fluoro-5-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | FOPGFTASWNNYSM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)OC(=O)N2)F |
Computed by PubChem (NCBI)