Products 1092347-86-8
CAS 1092347-86-8 is the registry number for 4-methoxy-7-(trifluoromethyl)-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methoxy-7-(trifluoromethyl)-2,3-dihydroinden-1-one (CAS 1092347-86-8) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 4-methoxy-7-(trifluoromethyl)-2,3-dihydroinden-1-one. InChIKey: NTTNMGQYIUGYJX-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 4-methoxy-7-(trifluoromethyl)-2,3-dihydroinden-1-one |
| InChIKey | NTTNMGQYIUGYJX-UHFFFAOYSA-N |
| SMILES | COC1=C2CCC(=O)C2=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)