Products 1092461-17-0

CAS 1092461-17-0 appears in our catalog under these names: 5-Chloro-2-(trifluoromethoxy)benzoyl chloride, 95%, 5-Chloro-2-(trifluoromethoxy)benzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-chloro-2-(trifluoromethoxy)benzoyl chloride (CAS 1092461-17-0) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 5-chloro-2-(trifluoromethoxy)benzoyl chloride. InChIKey: LMIAGDMILIYRFG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O2
Molecular weight259.01 g/mol
IUPAC name5-chloro-2-(trifluoromethoxy)benzoyl chloride
InChIKeyLMIAGDMILIYRFG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C(=O)Cl)OC(F)(F)F

Computed by PubChem (NCBI)