Products 871254-76-1
CAS 871254-76-1 appears in our catalog under these names: 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, 95%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, 97%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, ≥95%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, ≥99%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,5-dichloro-3-(trifluoromethyl)benzoic acid (CAS 871254-76-1) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,5-dichloro-3-(trifluoromethyl)benzoic acid. InChIKey: UMULTOMXQAIPCP-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 2,5-dichloro-3-(trifluoromethyl)benzoic acid |
| InChIKey | UMULTOMXQAIPCP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)