Products 871254-76-1

CAS 871254-76-1 appears in our catalog under these names: 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, 95%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, 97%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid, ≥95%, ≥95%, 2,5-Dichloro-3-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dichloro-3-(trifluoromethyl)benzoic acid (CAS 871254-76-1) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,5-dichloro-3-(trifluoromethyl)benzoic acid. InChIKey: UMULTOMXQAIPCP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O2
Molecular weight259.01 g/mol
IUPAC name2,5-dichloro-3-(trifluoromethyl)benzoic acid
InChIKeyUMULTOMXQAIPCP-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)Cl)C(F)(F)F)Cl

Computed by PubChem (NCBI)