Products 25922-43-4
CAS 25922-43-4 appears in our catalog under these names: 2,3-Dichloro-6-(trifluoromethyl)benzoic acid, 98%, 2,3-Dichloro-6-(trifluoromethyl)benzoic acid, 97+%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.
2,3-dichloro-6-(trifluoromethyl)benzoic acid (CAS 25922-43-4) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,3-dichloro-6-(trifluoromethyl)benzoic acid. InChIKey: BHQKUOSDTCYXEE-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 2,3-dichloro-6-(trifluoromethyl)benzoic acid |
| InChIKey | BHQKUOSDTCYXEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)