Products 25922-41-2
CAS 25922-41-2 appears in our catalog under these names: 2,6-dichloro-3-(trifluoromethyl)benzoic acid, 97%, 2,6-Dichloro-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg.
2,6-dichloro-3-(trifluoromethyl)benzoic acid (CAS 25922-41-2) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,6-dichloro-3-(trifluoromethyl)benzoic acid. InChIKey: WRNSEKNHEIXBES-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 2,6-dichloro-3-(trifluoromethyl)benzoic acid |
| InChIKey | WRNSEKNHEIXBES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-dichloro-3-(trifluoromethyl)benzoic Acid, 2,6-Dichloro-3-trifluoromethylbenzoic acid, Benzoic acid, 2,6-dichloro-3-(trifluoromethyl)-, 2,6-Dichloro-3-(trifluoromethyl)-benzoic acid, 2,6-Dichloro-3-(trifluoromethyl)benzoicacid, WRNSEKNHEIXBES-UHFFFAOYSA-N, 2,6-Dichloro-3-(trifluoromethyl)benzoicacid,97%, 2,6-Dichloro-3-(trifluoromethyl)-benzoic acid ISO 90012015 REACH