Products 1261779-42-3

CAS 1261779-42-3 appears in our catalog under these names: 4-Chloro-2-(trifluoromethoxy)benzoyl chloride, >90% tech., 4-Chloro-2-(trifluoromethoxy)benzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

4-chloro-2-(trifluoromethoxy)benzoyl chloride (CAS 1261779-42-3) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 4-chloro-2-(trifluoromethoxy)benzoyl chloride. InChIKey: ZYZNCCXCNJYIHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O2
Molecular weight259.01 g/mol
IUPAC name4-chloro-2-(trifluoromethoxy)benzoyl chloride
InChIKeyZYZNCCXCNJYIHJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)OC(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)