Products 261763-17-1

CAS 261763-17-1 is the registry number for 3-Chloro-4-(trifluoromethoxy)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

3-chloro-4-(trifluoromethoxy)benzoyl chloride (CAS 261763-17-1) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 3-chloro-4-(trifluoromethoxy)benzoyl chloride. InChIKey: BAFYBTOKEKLGKH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O2
Molecular weight259.01 g/mol
IUPAC name3-chloro-4-(trifluoromethoxy)benzoyl chloride
InChIKeyBAFYBTOKEKLGKH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)Cl)Cl)OC(F)(F)F

Computed by PubChem (NCBI)