CAS 1706458-41-4 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethyl)benzoic acid, 95%, 3,4-Dichloro-5-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
3,4-dichloro-5-(trifluoromethyl)benzoic acid (CAS 1706458-41-4) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzoic acid. InChIKey: CGVVUKYVRXMHQQ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethyl)benzoic acid |
| InChIKey | CGVVUKYVRXMHQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)