Products 1706458-41-4

CAS 1706458-41-4 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethyl)benzoic acid, 95%, 3,4-Dichloro-5-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3,4-dichloro-5-(trifluoromethyl)benzoic acid (CAS 1706458-41-4) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzoic acid. InChIKey: CGVVUKYVRXMHQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O2
Molecular weight259.01 g/mol
IUPAC name3,4-dichloro-5-(trifluoromethyl)benzoic acid
InChIKeyCGVVUKYVRXMHQQ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)