Products 118754-54-4
CAS 118754-54-4 appears in our catalog under these names: 2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde, 95%, 2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde, ≥95%, 2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg.
2,6-dichloro-4-(trifluoromethoxy)benzaldehyde (CAS 118754-54-4) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethoxy)benzaldehyde. InChIKey: OEMRSHNCSCRBQT-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | OEMRSHNCSCRBQT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)