CAS 1093565-68-4 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid (CAS 1093565-68-4) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: (2S)-2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid. InChIKey: RIBCAVCPRSRWDL-ZBHICJROSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | (2S)-2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid |
| InChIKey | RIBCAVCPRSRWDL-ZBHICJROSA-N |
| SMILES | C[C@@H](C(=O)O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)