CAS 15965-65-8 appears in our catalog under these names: 2,6-Dichloro-1-methyl-1H-benzo(d)imidazole, 95%, 2,6-Dichloro-1-methyl-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,6-dichloro-1-methylbenzimidazole (CAS 15965-65-8) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2,6-dichloro-1-methylbenzimidazole. InChIKey: UGDFPXYCSUHXBG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2,6-dichloro-1-methylbenzimidazole |
| InChIKey | UGDFPXYCSUHXBG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Cl)N=C1Cl |
Computed by PubChem (NCBI)