CAS 1094292-89-3 appears in our catalog under these names: 3-tert-butyl-7-chloro-(1,2,4)triazolo(4,3-c)pyrimidine, 98%, 3-tert-Butyl-7-chloro-(1,2,4)triazolo(4,3-c)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
3-tert-butyl-7-chloro-[1,2,4]triazolo[4,3-c]pyrimidine (CAS 1094292-89-3) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 3-tert-butyl-7-chloro-[1,2,4]triazolo[4,3-c]pyrimidine. InChIKey: VROUGZXQSCJFOS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 3-tert-butyl-7-chloro-[1,2,4]triazolo[4,3-c]pyrimidine |
| InChIKey | VROUGZXQSCJFOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C2N1C=NC(=C2)Cl |
Computed by PubChem (NCBI)