CAS 1107632-55-2 appears in our catalog under these names: (4-(1H-1,2,3-Triazol-1-yl)phenyl)methanamine hydrochloride, 95%, (4-(1H-1,2,3-Triazol-1-yl)phenyl)methanamine hydrochloride, 95+%, (4–(1H–1,2,3–Triazol–1–yl)phenyl)methanamine hydrochloride, (-4(1H-1,2,3-Triazol-1-Yl)Phenyl)Methanamine Hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
[4-(triazol-1-yl)phenyl]methanamine;hydrochloride (CAS 1107632-55-2) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: [4-(triazol-1-yl)phenyl]methanamine;hydrochloride. InChIKey: UNEHYEMYUJFBBU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | [4-(triazol-1-yl)phenyl]methanamine;hydrochloride |
| InChIKey | UNEHYEMYUJFBBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2C=CN=N2.Cl |
Computed by PubChem (NCBI)