CAS 2383553-83-9 is the registry number for 1-(tert-Butyl)-6-chloro-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butyl-6-chloropyrazolo[3,4-d]pyrimidine (CAS 2383553-83-9) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 1-tert-butyl-6-chloropyrazolo[3,4-d]pyrimidine. InChIKey: NYLPXCLBHDLSIA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 1-tert-butyl-6-chloropyrazolo[3,4-d]pyrimidine |
| InChIKey | NYLPXCLBHDLSIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC(=NC=C2C=N1)Cl |
Computed by PubChem (NCBI)