CAS 1107633-38-4 appears in our catalog under these names: [4-(1H-1,2,4-Triazol-1-yl)phenyl]methanamine hydrochloride, 95%, (4-(1H-1,2,4-Triazol-1-yl)phenyl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
[4-(1,2,4-triazol-1-yl)phenyl]methanamine;hydrochloride (CAS 1107633-38-4) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: [4-(1,2,4-triazol-1-yl)phenyl]methanamine;hydrochloride. InChIKey: XAVRTXPEJQCVOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | [4-(1,2,4-triazol-1-yl)phenyl]methanamine;hydrochloride |
| InChIKey | XAVRTXPEJQCVOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2C=NC=N2.Cl |
Computed by PubChem (NCBI)