CAS 85964-21-2 is the registry number for 1-(5-Chloro-2-pyridinyl)-5-methyl-4,5-dihydro-1h-pyrazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(5-chloro-2-pyridinyl)-3-methyl-3,4-dihydropyrazol-5-amine (CAS 85964-21-2) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 2-(5-chloro-2-pyridinyl)-3-methyl-3,4-dihydropyrazol-5-amine. InChIKey: UVBPMYBQHDMKKL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-(5-chloro-2-pyridinyl)-3-methyl-3,4-dihydropyrazol-5-amine |
| InChIKey | UVBPMYBQHDMKKL-UHFFFAOYSA-N |
| SMILES | CC1CC(=NN1C2=NC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)