CAS 1107635-36-8 is the registry number for (4-(2H-1,2,3-Triazol-2-yl)phenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-(triazol-2-yl)phenyl]methanamine;hydrochloride (CAS 1107635-36-8) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: [4-(triazol-2-yl)phenyl]methanamine;hydrochloride. InChIKey: SXXBFLUNDCKELV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | [4-(triazol-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | SXXBFLUNDCKELV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2N=CC=N2.Cl |
Computed by PubChem (NCBI)