Products 263401-62-3
CAS 263401-62-3 appears in our catalog under these names: 3-tert-Butyl-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine, 95%, 3-tert-butyl-6-chloro-(1,2,4)triazolo(4,3-b)pyridazine, 97%, 3-tert-Butyl-6-chloro-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g, 50mg.
3-tert-butyl-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (CAS 263401-62-3) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 3-tert-butyl-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: OIAUBHCLFFRPGV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 3-tert-butyl-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | OIAUBHCLFFRPGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C2N1N=C(C=C2)Cl |
Computed by PubChem (NCBI)