CAS 1803586-74-4 appears in our catalog under these names: 1-Benzyl-1H-1,2,3-triazol-4-amine hydrochloride, 1-Benzyl-1h-1,2,3-triazol-4-amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 10g, 5g, 1g.
1-benzyltriazol-4-amine;hydrochloride (CAS 1803586-74-4) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 1-benzyltriazol-4-amine;hydrochloride. InChIKey: UMCXRTLSNDOUAI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 1-benzyltriazol-4-amine;hydrochloride |
| InChIKey | UMCXRTLSNDOUAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)N.Cl |
Computed by PubChem (NCBI)