Products 1094294-15-1

CAS 1094294-15-1 appears in our catalog under these names: 2-(5-Bromo-2-methoxyphenyl)-2-oxoacetic acid, 95%, 2-(5-Bromo-2-methoxyphenyl)-2-oxoacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(5-bromo-2-methoxyphenyl)-2-oxoacetic acid (CAS 1094294-15-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-(5-bromo-2-methoxyphenyl)-2-oxoacetic acid. InChIKey: KXORPQBUTLEDJR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrO4
Molecular weight259.05 g/mol
IUPAC name2-(5-bromo-2-methoxyphenyl)-2-oxoacetic acid
InChIKeyKXORPQBUTLEDJR-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)Br)C(=O)C(=O)O

Computed by PubChem (NCBI)