Products 1094294-16-2

CAS 1094294-16-2 is the registry number for 2-(2,5-Difluorophenyl)-2-oxoacetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(2,5-difluorophenyl)-2-oxoacetic acid (CAS 1094294-16-2) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-2-oxoacetic acid. InChIKey: DEUVZBPLJXDMDX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F2O3
Molecular weight186.11 g/mol
IUPAC name2-(2,5-difluorophenyl)-2-oxoacetic acid
InChIKeyDEUVZBPLJXDMDX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(=O)C(=O)O)F

Computed by PubChem (NCBI)