CAS 109496-98-2 appears in our catalog under these names: 5-Phenyl-2,3-dihydro-1H-indole-2,3-dione, 97%, 5-Phenyl-2,3-dihydro-1h-indole-2,3-dione, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 100mg, 250mg, 1g, 500mg, 2.5g.
5-phenyl-1H-indole-2,3-dione (CAS 109496-98-2) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 5-phenyl-1H-indole-2,3-dione. InChIKey: SCYQIRIBDBKXGG-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 5-phenyl-1H-indole-2,3-dione |
| InChIKey | SCYQIRIBDBKXGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)