Products 1096934-06-3
CAS 1096934-06-3 is the registry number for Bis(4-chlorophenyl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,4-bis(4-chlorophenyl)-1,2-oxazol-5-amine (CAS 1096934-06-3) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 3,4-bis(4-chlorophenyl)-1,2-oxazol-5-amine. InChIKey: DLJUSOPVEJABLR-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 3,4-bis(4-chlorophenyl)-1,2-oxazol-5-amine |
| InChIKey | DLJUSOPVEJABLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(ON=C2C3=CC=C(C=C3)Cl)N)Cl |
Computed by PubChem (NCBI)