CAS 5958-24-7 appears in our catalog under these names: 6-Chloro-2-(chloromethyl)-4-phenyl-quinazoline, >95% (HPLC), 6-Chloro-2-(chloromethyl)-4-phenylquinazoline 3-Oxide, Chlordiazepoxide EP Impurity B, 6-Chloro-2-(chloromethyl)-4-phenyl-quinazoline. Offered by: TRC, Mikromol, Biosynth. Available pack sizes: 100mg, 1g, 4x25mg, 25mg, 250mg, 500mg, 1000mg.
6-chloro-2-(chloromethyl)-3-oxido-4-phenylquinazolin-3-ium (CAS 5958-24-7) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 6-chloro-2-(chloromethyl)-3-oxido-4-phenylquinazolin-3-ium. InChIKey: KFDNKXWSTFABQT-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 6-chloro-2-(chloromethyl)-3-oxido-4-phenylquinazolin-3-ium |
| InChIKey | KFDNKXWSTFABQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=[N+](C(=NC3=C2C=C(C=C3)Cl)CCl)[O-] |
Computed by PubChem (NCBI)