CAS 5571-60-8 is the registry number for 1-Demethyl-4'-chlorodiazepam. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
7-chloro-5-(4-chlorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 5571-60-8) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 7-chloro-5-(4-chlorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: XKAHDJVCUSNHTE-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 7-chloro-5-(4-chlorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | XKAHDJVCUSNHTE-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)