CAS 84344-12-7 is the registry number for Delorazepam-D4 0.1 mg/ml in Methanol. Offered by: LoGiCal. Available pack sizes: 1ml.
7-chloro-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 84344-12-7) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 309.2 g/mol. IUPAC name: 7-chloro-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: CHIFCDOIPRCHCF-RHQRLBAQSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 7-chloro-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | CHIFCDOIPRCHCF-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NCC(=O)NC3=C2C=C(C=C3)Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)