CAS 174636-68-1 is the registry number for 2-(Pyridin-4-yl)quinoline-4-carbonyl chloride hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-pyridin-4-ylquinoline-4-carbonyl chloride;hydrochloride (CAS 174636-68-1) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 2-pyridin-4-ylquinoline-4-carbonyl chloride;hydrochloride. InChIKey: NABMOZMVHRWZBK-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 2-pyridin-4-ylquinoline-4-carbonyl chloride;hydrochloride |
| InChIKey | NABMOZMVHRWZBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=NC=C3)C(=O)Cl.Cl |
Computed by PubChem (NCBI)